C26H27N3O4 — CID 19112545
(5E)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[4-(dimethylamino)phenyl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112545) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is (5E)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[4-(dimethylamino)phenyl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[4-(dimethylamino)phenyl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112545 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (5E)-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[4-(dimethylamino)phenyl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | COc1ccc(CCN2C(=O)C(C#N)=C(C)/C(=C\c3ccc(N(C)C)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C26H27N3O4/c1-17-21(14-18-6-9-20(10-7-18)28(2)3)25(30)29(26(31)22(17)16-27)13-12-19-8-11-23(32-4)24(15-19)33-5/h6-11,14-15H,12-13H2,1-5H3/b21-14+ |
| InChIKey | HCSJWOJMYXDWGP-KGENOOAVSA-N |
| XLogP | 3.60 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|