C28H33N3O3S2 — CID 19114566
N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 19114566) has the molecular formula C28H33N3O3S2 and a molecular weight of 523.72 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 19114566 |
| Molecular Formula | C28H33N3O3S2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | COc1ccc(C(CNC(=O)CCN2C(=O)/C(=C/c3ccc(C)cc3)SC2=S)N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H33N3O3S2/c1-20-6-8-21(9-7-20)18-25-27(33)31(28(35)36-25)17-14-26(32)29-19-24(30-15-4-3-5-16-30)22-10-12-23(34-2)13-11-22/h6-13,18,24H,3-5,14-17,19H2,1-2H3,(H,29,32)/b25-18- |
| InChIKey | KRTDXHONUUSKCC-BWAHOGKJSA-N |
| XLogP | 4.94 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|