C29H35N3O4S2 — CID 19114573
4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]butanamide (PubChem CID 19114573) has the molecular formula C29H35N3O4S2 and a molecular weight of 553.75 g/mol. Its IUPAC name is 4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]butanamide.
| Compound Name | 4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]butanamide |
|---|---|
| PubChem CID | 19114573 |
| Molecular Formula | C29H35N3O4S2 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | 4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]butanamide |
| SMILES | COc1ccc(/C=C2\SC(=S)N(CCCC(=O)NCC(c3ccc(OC)cc3)N3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C29H35N3O4S2/c1-35-23-12-8-21(9-13-23)19-26-28(34)32(29(37)38-26)18-6-7-27(33)30-20-25(31-16-4-3-5-17-31)22-10-14-24(36-2)15-11-22/h8-15,19,25H,3-7,16-18,20H2,1-2H3,(H,30,33)/b26-19- |
| InChIKey | KPWBILBZPHHHGT-XHPQRKPJSA-N |
| XLogP | 5.03 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|