C15H12N2O4 — CID 19115624
5-(furan-2-carbonyl)-6-hydroxy-4-methyl-2-oxo-1-prop-2-enylpyridine-3-carbonitrile (PubChem CID 19115624) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is 5-(furan-2-carbonyl)-6-hydroxy-4-methyl-2-oxo-1-prop-2-enylpyridine-3-carbonitrile.
| Compound Name | 5-(furan-2-carbonyl)-6-hydroxy-4-methyl-2-oxo-1-prop-2-enylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19115624 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 5-(furan-2-carbonyl)-6-hydroxy-4-methyl-2-oxo-1-prop-2-enylpyridine-3-carbonitrile |
| SMILES | C=CCn1c(O)c(C(=O)c2ccco2)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C15H12N2O4/c1-3-6-17-14(19)10(8-16)9(2)12(15(17)20)13(18)11-5-4-7-21-11/h3-5,7,20H,1,6H2,2H3 |
| InChIKey | NABOHUFVJHNRSZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|