C30H45NO3 — CID 54511237
N,N-diethyl-3-(5-octadeca-9,12,15-trienoylfuran-2-yl)but-2-enamide (PubChem CID 54511237) has the molecular formula C30H45NO3 and a molecular weight of 467.69 g/mol. Its IUPAC name is N,N-diethyl-3-(5-octadeca-9,12,15-trienoylfuran-2-yl)but-2-enamide.
| Compound Name | N,N-diethyl-3-(5-octadeca-9,12,15-trienoylfuran-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 54511237 |
| Molecular Formula | C30H45NO3 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 467.34 |
| IUPAC Name | N,N-diethyl-3-(5-octadeca-9,12,15-trienoylfuran-2-yl)but-2-enamide |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)c1ccc(C(C)=CC(=O)N(CC)CC)o1 |
| InChI | InChI=1S/C30H45NO3/c1-5-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27(32)29-24-23-28(34-29)26(4)25-30(33)31(6-2)7-3/h8-9,11-12,14-15,23-25H,5-7,10,13,16-22H2,1-4H3 |
| InChIKey | YJGOOAVMOSPOIM-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|