C16H16Br2N2O4 — CID 19132776
6,8-dibromo-3-[4-(2-hydroxyethyl)piperazine-1-carbonyl]chromen-2-one (PubChem CID 19132776) has the molecular formula C16H16Br2N2O4 and a molecular weight of 460.12 g/mol. Its IUPAC name is 6,8-dibromo-3-[4-(2-hydroxyethyl)piperazine-1-carbonyl]chromen-2-one.
| Compound Name | 6,8-dibromo-3-[4-(2-hydroxyethyl)piperazine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 19132776 |
| Molecular Formula | C16H16Br2N2O4 |
| Molecular Weight | 460.12 g/mol |
| Exact Mass | 457.95 |
| IUPAC Name | 6,8-dibromo-3-[4-(2-hydroxyethyl)piperazine-1-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2cc(Br)cc(Br)c2oc1=O)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C16H16Br2N2O4/c17-11-7-10-8-12(16(23)24-14(10)13(18)9-11)15(22)20-3-1-19(2-4-20)5-6-21/h7-9,21H,1-6H2 |
| InChIKey | KZOCPMCPHIZKFS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.12 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|