C19H26N2O3 — CID 19133673
2-N,2-N-diethyl-1-N-(3-methoxyphenyl)cyclohex-4-ene-1,2-dicarboxamide (PubChem CID 19133673) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-N,2-N-diethyl-1-N-(3-methoxyphenyl)cyclohex-4-ene-1,2-dicarboxamide.
| Compound Name | 2-N,2-N-diethyl-1-N-(3-methoxyphenyl)cyclohex-4-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 19133673 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-N,2-N-diethyl-1-N-(3-methoxyphenyl)cyclohex-4-ene-1,2-dicarboxamide |
| SMILES | CCN(CC)C(=O)C1CC=CCC1C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C19H26N2O3/c1-4-21(5-2)19(23)17-12-7-6-11-16(17)18(22)20-14-9-8-10-15(13-14)24-3/h6-10,13,16-17H,4-5,11-12H2,1-3H3,(H,20,22) |
| InChIKey | WQVFIQKYDLSUEH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|