C18H17Cl2N5 — CID 19138034
4-N-(2,5-dichlorophenyl)-6-N-(2-phenylethyl)pyrimidine-4,5,6-triamine (PubChem CID 19138034) has the molecular formula C18H17Cl2N5 and a molecular weight of 374.28 g/mol. Its IUPAC name is 4-N-(2,5-dichlorophenyl)-6-N-(2-phenylethyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(2,5-dichlorophenyl)-6-N-(2-phenylethyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19138034 |
| Molecular Formula | C18H17Cl2N5 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 4-N-(2,5-dichlorophenyl)-6-N-(2-phenylethyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCCc2ccccc2)ncnc1Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H17Cl2N5/c19-13-6-7-14(20)15(10-13)25-18-16(21)17(23-11-24-18)22-9-8-12-4-2-1-3-5-12/h1-7,10-11H,8-9,21H2,(H2,22,23,24,25) |
| InChIKey | WLNNHEZUPHKFCL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |