C17H24N6O2S — CID 19140352
N'-[5-amino-6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide (PubChem CID 19140352) has the molecular formula C17H24N6O2S and a molecular weight of 376.49 g/mol. Its IUPAC name is N'-[5-amino-6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide.
| Compound Name | N'-[5-amino-6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 19140352 |
| Molecular Formula | C17H24N6O2S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N'-[5-amino-6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNc2ncnc(N3CCC(C)CC3)c2N)cc1 |
| InChI | InChI=1S/C17H24N6O2S/c1-12-3-5-14(6-4-12)26(24,25)22-21-16-15(18)17(20-11-19-16)23-9-7-13(2)8-10-23/h3-6,11,13,22H,7-10,18H2,1-2H3,(H,19,20,21) |
| InChIKey | JOVVSYGXGLOGPD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|