C16H24N6OS — CID 19140747
2-[4-[5-amino-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]piperazin-1-yl]ethanol (PubChem CID 19140747) has the molecular formula C16H24N6OS and a molecular weight of 348.48 g/mol. Its IUPAC name is 2-[4-[5-amino-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[5-amino-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 19140747 |
| Molecular Formula | C16H24N6OS |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[4-[5-amino-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]piperazin-1-yl]ethanol |
| SMILES | Nc1c(NCCc2cccs2)ncnc1N1CCN(CCO)CC1 |
| InChI | InChI=1S/C16H24N6OS/c17-14-15(18-4-3-13-2-1-11-24-13)19-12-20-16(14)22-7-5-21(6-8-22)9-10-23/h1-2,11-12,23H,3-10,17H2,(H,18,19,20) |
| InChIKey | KNFMPPCSJGIHQP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |