C15H20N6O2 — CID 19142197
ethyl 1-(5-amino-6-imidazol-1-ylpyrimidin-4-yl)piperidine-4-carboxylate (PubChem CID 19142197) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is ethyl 1-(5-amino-6-imidazol-1-ylpyrimidin-4-yl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(5-amino-6-imidazol-1-ylpyrimidin-4-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 19142197 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | ethyl 1-(5-amino-6-imidazol-1-ylpyrimidin-4-yl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(-n3ccnc3)c2N)CC1 |
| InChI | InChI=1S/C15H20N6O2/c1-2-23-15(22)11-3-6-20(7-4-11)13-12(16)14(19-9-18-13)21-8-5-17-10-21/h5,8-11H,2-4,6-7,16H2,1H3 |
| InChIKey | USBKNUDNMYATJB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |