C13H10N4OS — CID 19152730
5-amino-4-quinolin-8-ylsulfanyl-1H-pyrimidin-6-one (PubChem CID 19152730) has the molecular formula C13H10N4OS and a molecular weight of 270.32 g/mol. Its IUPAC name is 5-amino-4-quinolin-8-ylsulfanyl-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-quinolin-8-ylsulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 19152730 |
| Molecular Formula | C13H10N4OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 5-amino-4-quinolin-8-ylsulfanyl-1H-pyrimidin-6-one |
| SMILES | Nc1c(Sc2cccc3cccnc23)nc[nH]c1=O |
| InChI | InChI=1S/C13H10N4OS/c14-10-12(18)16-7-17-13(10)19-9-5-1-3-8-4-2-6-15-11(8)9/h1-7H,14H2,(H,16,17,18) |
| InChIKey | VWBSXLVSCVDYFB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |