C21H18N4OS — CID 19154336
4-(3,4-dimethylphenoxy)-6-quinolin-8-ylsulfanylpyrimidin-5-amine (PubChem CID 19154336) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is 4-(3,4-dimethylphenoxy)-6-quinolin-8-ylsulfanylpyrimidin-5-amine.
| Compound Name | 4-(3,4-dimethylphenoxy)-6-quinolin-8-ylsulfanylpyrimidin-5-amine |
|---|---|
| PubChem CID | 19154336 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-(3,4-dimethylphenoxy)-6-quinolin-8-ylsulfanylpyrimidin-5-amine |
| SMILES | Cc1ccc(Oc2ncnc(Sc3cccc4cccnc34)c2N)cc1C |
| InChI | InChI=1S/C21H18N4OS/c1-13-8-9-16(11-14(13)2)26-20-18(22)21(25-12-24-20)27-17-7-3-5-15-6-4-10-23-19(15)17/h3-12H,22H2,1-2H3 |
| InChIKey | GMHGRLQDEYCZFB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |