C21H17BrN4O2 — CID 19152831
4-(5-bromoquinolin-8-yl)oxy-6-(3,4-dimethylphenoxy)pyrimidin-5-amine (PubChem CID 19152831) has the molecular formula C21H17BrN4O2 and a molecular weight of 437.30 g/mol. Its IUPAC name is 4-(5-bromoquinolin-8-yl)oxy-6-(3,4-dimethylphenoxy)pyrimidin-5-amine.
| Compound Name | 4-(5-bromoquinolin-8-yl)oxy-6-(3,4-dimethylphenoxy)pyrimidin-5-amine |
|---|---|
| PubChem CID | 19152831 |
| Molecular Formula | C21H17BrN4O2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 4-(5-bromoquinolin-8-yl)oxy-6-(3,4-dimethylphenoxy)pyrimidin-5-amine |
| SMILES | Cc1ccc(Oc2ncnc(Oc3ccc(Br)c4cccnc34)c2N)cc1C |
| InChI | InChI=1S/C21H17BrN4O2/c1-12-5-6-14(10-13(12)2)27-20-18(23)21(26-11-25-20)28-17-8-7-16(22)15-4-3-9-24-19(15)17/h3-11H,23H2,1-2H3 |
| InChIKey | LOUVHOCIUKZIJF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |