C25H18O6 — CID 19167305
[4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenyl] 3-methoxybenzoate (PubChem CID 19167305) has the molecular formula C25H18O6 and a molecular weight of 414.41 g/mol. Its IUPAC name is [4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenyl] 3-methoxybenzoate.
| Compound Name | [4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 19167305 |
| Molecular Formula | C25H18O6 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C=C3C(=O)c4ccccc4C3=O)cc2OC)c1 |
| InChI | InChI=1S/C25H18O6/c1-29-17-7-5-6-16(14-17)25(28)31-21-11-10-15(13-22(21)30-2)12-20-23(26)18-8-3-4-9-19(18)24(20)27/h3-14H,1-2H3 |
| InChIKey | HAPBOQZNAJGPPO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|