C26H17ClO5 — CID 19167312
[4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 19167312) has the molecular formula C26H17ClO5 and a molecular weight of 444.87 g/mol. Its IUPAC name is [4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19167312 |
| Molecular Formula | C26H17ClO5 |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | [4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | COc1cc(C=C2C(=O)c3ccccc3C2=O)ccc1OC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H17ClO5/c1-31-23-15-17(14-21-25(29)19-4-2-3-5-20(19)26(21)30)8-12-22(23)32-24(28)13-9-16-6-10-18(27)11-7-16/h2-15H,1H3/b13-9+ |
| InChIKey | GMCIHNFNBBXBMJ-UKTHLTGXSA-N |
| XLogP | 5.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|