C29H26O6 — CID 19167327
[4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenyl] 2-(5-methyl-2-propan-2-ylphenoxy)acetate (PubChem CID 19167327) has the molecular formula C29H26O6 and a molecular weight of 470.52 g/mol. Its IUPAC name is [4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenyl] 2-(5-methyl-2-propan-2-ylphenoxy)acetate.
| Compound Name | [4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenyl] 2-(5-methyl-2-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 19167327 |
| Molecular Formula | C29H26O6 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | [4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenyl] 2-(5-methyl-2-propan-2-ylphenoxy)acetate |
| SMILES | COc1cc(C=C2C(=O)c3ccccc3C2=O)ccc1OC(=O)COc1cc(C)ccc1C(C)C |
| InChI | InChI=1S/C29H26O6/c1-17(2)20-11-9-18(3)13-25(20)34-16-27(30)35-24-12-10-19(15-26(24)33-4)14-23-28(31)21-7-5-6-8-22(21)29(23)32/h5-15,17H,16H2,1-4H3 |
| InChIKey | PJMRNWFZMZTWAF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|