C24H24N4O5S — CID 19177177
(E)-2-cyano-N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-(4-propoxyphenyl)prop-2-enamide (PubChem CID 19177177) has the molecular formula C24H24N4O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is (E)-2-cyano-N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-(4-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-(4-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19177177 |
| Molecular Formula | C24H24N4O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (E)-2-cyano-N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-(4-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccc(/C=C(\C#N)C(=O)Nc2ccc(S(=O)(=O)Nc3onc(C)c3C)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O5S/c1-4-13-32-21-9-5-18(6-10-21)14-19(15-25)23(29)26-20-7-11-22(12-8-20)34(30,31)28-24-16(2)17(3)27-33-24/h5-12,14,28H,4,13H2,1-3H3,(H,26,29)/b19-14+ |
| InChIKey | LSRVXVXJXBRZBO-XMHGGMMESA-N |
| XLogP | 4.43 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|