C24H24BrNO6 — CID 19187246
[3-(butan-2-ylcarbamoyl)-2-oxochromen-7-yl] 2-(4-bromo-2,6-dimethylphenoxy)acetate (PubChem CID 19187246) has the molecular formula C24H24BrNO6 and a molecular weight of 502.36 g/mol. Its IUPAC name is [3-(butan-2-ylcarbamoyl)-2-oxochromen-7-yl] 2-(4-bromo-2,6-dimethylphenoxy)acetate.
| Compound Name | [3-(butan-2-ylcarbamoyl)-2-oxochromen-7-yl] 2-(4-bromo-2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 19187246 |
| Molecular Formula | C24H24BrNO6 |
| Molecular Weight | 502.36 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | [3-(butan-2-ylcarbamoyl)-2-oxochromen-7-yl] 2-(4-bromo-2,6-dimethylphenoxy)acetate |
| SMILES | CCC(C)NC(=O)c1cc2ccc(OC(=O)COc3c(C)cc(Br)cc3C)cc2oc1=O |
| InChI | InChI=1S/C24H24BrNO6/c1-5-15(4)26-23(28)19-10-16-6-7-18(11-20(16)32-24(19)29)31-21(27)12-30-22-13(2)8-17(25)9-14(22)3/h6-11,15H,5,12H2,1-4H3,(H,26,28) |
| InChIKey | ICSJPCHMAZFOFE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|