C21H24ClNO4 — CID 19191236
propyl 3-[4-(4-chloro-3-methylphenoxy)butanoylamino]benzoate (PubChem CID 19191236) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is propyl 3-[4-(4-chloro-3-methylphenoxy)butanoylamino]benzoate.
| Compound Name | propyl 3-[4-(4-chloro-3-methylphenoxy)butanoylamino]benzoate |
|---|---|
| PubChem CID | 19191236 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | propyl 3-[4-(4-chloro-3-methylphenoxy)butanoylamino]benzoate |
| SMILES | CCCOC(=O)c1cccc(NC(=O)CCCOc2ccc(Cl)c(C)c2)c1 |
| InChI | InChI=1S/C21H24ClNO4/c1-3-11-27-21(25)16-6-4-7-17(14-16)23-20(24)8-5-12-26-18-9-10-19(22)15(2)13-18/h4,6-7,9-10,13-14H,3,5,8,11-12H2,1-2H3,(H,23,24) |
| InChIKey | BKBYOINHBCJZFK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|