C22H25NO4 — CID 108808028
propyl 3-[[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]benzoate (PubChem CID 108808028) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is propyl 3-[[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]benzoate.
| Compound Name | propyl 3-[[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108808028 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | propyl 3-[[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cccc(NC(=O)CCC(=O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C22H25NO4/c1-4-12-27-22(26)18-6-5-7-19(14-18)23-21(25)11-10-20(24)17-9-8-15(2)16(3)13-17/h5-9,13-14H,4,10-12H2,1-3H3,(H,23,25) |
| InChIKey | CNYUELGCTRFTAQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |