C23H24N2O6 — CID 19195672
(4-nitrophenyl) (E)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 19195672) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is (4-nitrophenyl) (E)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | (4-nitrophenyl) (E)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19195672 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (4-nitrophenyl) (E)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCOc1ccc(/C=C(\C#N)C(=O)Oc2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C23H24N2O6/c1-3-4-5-6-13-30-21-12-7-17(15-22(21)29-2)14-18(16-24)23(26)31-20-10-8-19(9-11-20)25(27)28/h7-12,14-15H,3-6,13H2,1-2H3/b18-14+ |
| InChIKey | SQUUYLKPLLNGMS-NBVRZTHBSA-N |
| XLogP | 5.08 |
| TPSA | 111.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|