C18H25N3O3S — CID 19197187
4-(4-methoxyphenoxy)-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 19197187) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-(4-methoxyphenoxy)-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 19197187 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-(4-methoxyphenoxy)-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCC(CC)c1nnc(NC(=O)CCCOc2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C18H25N3O3S/c1-4-13(5-2)17-20-21-18(25-17)19-16(22)7-6-12-24-15-10-8-14(23-3)9-11-15/h8-11,13H,4-7,12H2,1-3H3,(H,19,21,22) |
| InChIKey | FGBFSZVCXRWIOC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|