C21H21BrN4O3S2 — CID 19204915
N-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 19204915) has the molecular formula C21H21BrN4O3S2 and a molecular weight of 521.46 g/mol. Its IUPAC name is N-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 19204915 |
| Molecular Formula | C21H21BrN4O3S2 |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | N-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | COc1cc(C=NNC(=O)CSc2nnc(-c3ccccc3)s2)cc(Br)c1OC(C)C |
| InChI | InChI=1S/C21H21BrN4O3S2/c1-13(2)29-19-16(22)9-14(10-17(19)28-3)11-23-24-18(27)12-30-21-26-25-20(31-21)15-7-5-4-6-8-15/h4-11,13H,12H2,1-3H3,(H,24,27) |
| InChIKey | FGCPJPRTYQJBOT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|