C17H23BrClNO3 — CID 19205856
4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-(oxolan-2-ylmethyl)butanamide (PubChem CID 19205856) has the molecular formula C17H23BrClNO3 and a molecular weight of 404.73 g/mol. Its IUPAC name is 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-(oxolan-2-ylmethyl)butanamide.
| Compound Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-(oxolan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 19205856 |
| Molecular Formula | C17H23BrClNO3 |
| Molecular Weight | 404.73 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-(oxolan-2-ylmethyl)butanamide |
| SMILES | Cc1cc(OCCCC(=O)NCC2CCCO2)c(Br)c(C)c1Cl |
| InChI | InChI=1S/C17H23BrClNO3/c1-11-9-14(16(18)12(2)17(11)19)23-8-4-6-15(21)20-10-13-5-3-7-22-13/h9,13H,3-8,10H2,1-2H3,(H,20,21) |
| InChIKey | SQEFOZZSXQOBHY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.73 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|