C23H29BrN2O3S — CID 19206269
2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 19206269) has the molecular formula C23H29BrN2O3S and a molecular weight of 493.47 g/mol. Its IUPAC name is 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 19206269 |
| Molecular Formula | C23H29BrN2O3S |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC1CCc2c(sc(NC(=O)CCCOc3ccc(C(C)C)cc3Br)c2C(N)=O)C1 |
| InChI | InChI=1S/C23H29BrN2O3S/c1-13(2)15-7-9-18(17(24)12-15)29-10-4-5-20(27)26-23-21(22(25)28)16-8-6-14(3)11-19(16)30-23/h7,9,12-14H,4-6,8,10-11H2,1-3H3,(H2,25,28)(H,26,27) |
| InChIKey | JGOYFCVUDZWHED-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|