C22H27BrN2O3S — CID 19206257
2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 19206257) has the molecular formula C22H27BrN2O3S and a molecular weight of 479.44 g/mol. Its IUPAC name is 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 19206257 |
| Molecular Formula | C22H27BrN2O3S |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)c1ccc(OCCCC(=O)Nc2sc3c(c2C(N)=O)CCCC3)c(Br)c1 |
| InChI | InChI=1S/C22H27BrN2O3S/c1-13(2)14-9-10-17(16(23)12-14)28-11-5-8-19(26)25-22-20(21(24)27)15-6-3-4-7-18(15)29-22/h9-10,12-13H,3-8,11H2,1-2H3,(H2,24,27)(H,25,26) |
| InChIKey | XBTYCKBELBVCLN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|