C19H21BrN2O3S — CID 19202134
2-[4-(2-bromo-4-methylphenoxy)butanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 19202134) has the molecular formula C19H21BrN2O3S and a molecular weight of 437.36 g/mol. Its IUPAC name is 2-[4-(2-bromo-4-methylphenoxy)butanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[4-(2-bromo-4-methylphenoxy)butanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 19202134 |
| Molecular Formula | C19H21BrN2O3S |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-[4-(2-bromo-4-methylphenoxy)butanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | Cc1ccc(OCCCC(=O)Nc2sc3c(c2C(N)=O)CCC3)c(Br)c1 |
| InChI | InChI=1S/C19H21BrN2O3S/c1-11-7-8-14(13(20)10-11)25-9-3-6-16(23)22-19-17(18(21)24)12-4-2-5-15(12)26-19/h7-8,10H,2-6,9H2,1H3,(H2,21,24)(H,22,23) |
| InChIKey | QMUYYODAXFULSY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|