C18H16N2O2S — CID 19209658
6-ethoxy-2-(2-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole (PubChem CID 19209658) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 6-ethoxy-2-(2-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 6-ethoxy-2-(2-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 19209658 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 6-ethoxy-2-(2-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole |
| SMILES | CCOc1ccc2c(c1)sc1nc(-c3ccccc3OC)cn12 |
| InChI | InChI=1S/C18H16N2O2S/c1-3-22-12-8-9-15-17(10-12)23-18-19-14(11-20(15)18)13-6-4-5-7-16(13)21-2/h4-11H,3H2,1-2H3 |
| InChIKey | REWJBPPYJABJJL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |