C12H13N3OS — CID 28750479
(6-ethoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)methanamine (PubChem CID 28750479) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is (6-ethoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)methanamine.
| Compound Name | (6-ethoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 28750479 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (6-ethoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)methanamine |
| SMILES | CCOc1ccc2c(c1)sc1nc(CN)cn12 |
| InChI | InChI=1S/C12H13N3OS/c1-2-16-9-3-4-10-11(5-9)17-12-14-8(6-13)7-15(10)12/h3-5,7H,2,6,13H2,1H3 |
| InChIKey | XQNVXRDWYPRDDQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |