C25H22N2O6S — CID 19219066
2-(1,3-dioxoisoindol-2-yl)-N-(4-methoxyphenyl)-N-(4-methylphenyl)sulfonylpropanamide (PubChem CID 19219066) has the molecular formula C25H22N2O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(4-methoxyphenyl)-N-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-methoxyphenyl)-N-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 19219066 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-methoxyphenyl)-N-(4-methylphenyl)sulfonylpropanamide |
| SMILES | COc1ccc(N(C(=O)C(C)N2C(=O)c3ccccc3C2=O)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H22N2O6S/c1-16-8-14-20(15-9-16)34(31,32)27(18-10-12-19(33-3)13-11-18)23(28)17(2)26-24(29)21-6-4-5-7-22(21)25(26)30/h4-15,17H,1-3H3 |
| InChIKey | ADHGAKHKBNVOIB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|