About (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate
(2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate (PubChem CID 19225786) has the molecular formula C22H14BrClO3S
and a molecular weight of 473.78 g/mol. Its IUPAC name is (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate |
| PubChem CID | 19225786 |
| Molecular Formula | C22H14BrClO3S |
| Molecular Weight | 473.78 g/mol |
| Exact Mass | 471.95 |
| IUPAC Name | (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc2sc(C(=O)Oc3ccc(-c4ccccc4)cc3Br)c(Cl)c2c1 |
| InChI | InChI=1S/C22H14BrClO3S/c1-26-15-8-10-19-16(12-15)20(24)21(28-19)22(25)27-18-9-7-14(11-17(18)23)13-5-3-2-4-6-13/h2-12H,1H3 |
| InChIKey | MYQFNAIFQLYFQE-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.78 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate?
The IUPAC name of (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate (CID 19225786) is (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate.
What is the SMILES notation for (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate?
The canonical SMILES for (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate is COc1ccc2sc(C(=O)Oc3ccc(-c4ccccc4)cc3Br)c(Cl)c2c1.
What is the InChIKey of (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate?
The InChIKey is MYQFNAIFQLYFQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14BrClO3S/c1-26-15-8-10-19-16(12-15)20(24)21(28-19)22(25)27-18-9-7-14(11-17(18)23)13-5-3-2-4-6-13/h2-12H,1H3.
What are the key properties of (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate?
(2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate has a molecular weight of 473.78 g/mol, XLogP of 7.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4-phenylphenyl) 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 19225786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).