C33H43N3O2 — CID 19243130
N-[2-[1-[3-(4-tert-butylphenoxy)propyl]benzimidazol-2-yl]ethyl]adamantane-1-carboxamide (PubChem CID 19243130) has the molecular formula C33H43N3O2 and a molecular weight of 513.73 g/mol. Its IUPAC name is N-[2-[1-[3-(4-tert-butylphenoxy)propyl]benzimidazol-2-yl]ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[1-[3-(4-tert-butylphenoxy)propyl]benzimidazol-2-yl]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 19243130 |
| Molecular Formula | C33H43N3O2 |
| Molecular Weight | 513.73 g/mol |
| Exact Mass | 513.34 |
| IUPAC Name | N-[2-[1-[3-(4-tert-butylphenoxy)propyl]benzimidazol-2-yl]ethyl]adamantane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(OCCCn2c(CCNC(=O)C34CC5CC(CC(C5)C3)C4)nc3ccccc32)cc1 |
| InChI | InChI=1S/C33H43N3O2/c1-32(2,3)26-9-11-27(12-10-26)38-16-6-15-36-29-8-5-4-7-28(29)35-30(36)13-14-34-31(37)33-20-23-17-24(21-33)19-25(18-23)22-33/h4-5,7-12,23-25H,6,13-22H2,1-3H3,(H,34,37) |
| InChIKey | HBYPITFJRGEWLV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.73 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|