C34H45N3O2 — CID 19243140
N-[2-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]adamantane-1-carboxamide (PubChem CID 19243140) has the molecular formula C34H45N3O2 and a molecular weight of 527.75 g/mol. Its IUPAC name is N-[2-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 19243140 |
| Molecular Formula | C34H45N3O2 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.35 |
| IUPAC Name | N-[2-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]adamantane-1-carboxamide |
| SMILES | Cc1ccc(C(C)C)c(OCCCCn2c(CCNC(=O)C34CC5CC(CC(C5)C3)C4)nc3ccccc32)c1 |
| InChI | InChI=1S/C34H45N3O2/c1-23(2)28-11-10-24(3)16-31(28)39-15-7-6-14-37-30-9-5-4-8-29(30)36-32(37)12-13-35-33(38)34-20-25-17-26(21-34)19-27(18-25)22-34/h4-5,8-11,16,23,25-27H,6-7,12-15,17-22H2,1-3H3,(H,35,38) |
| InChIKey | SPZBXDOODNPZTK-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|