C32H41N3O2 — CID 19243139
N-[2-[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]adamantane-1-carboxamide (PubChem CID 19243139) has the molecular formula C32H41N3O2 and a molecular weight of 499.70 g/mol. Its IUPAC name is N-[2-[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 19243139 |
| Molecular Formula | C32H41N3O2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | N-[2-[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]adamantane-1-carboxamide |
| SMILES | Cc1ccc(C)c(OCCCCn2c(CCNC(=O)C34CC5CC(CC(C5)C3)C4)nc3ccccc32)c1 |
| InChI | InChI=1S/C32H41N3O2/c1-22-9-10-23(2)29(15-22)37-14-6-5-13-35-28-8-4-3-7-27(28)34-30(35)11-12-33-31(36)32-19-24-16-25(20-32)18-26(17-24)21-32/h3-4,7-10,15,24-26H,5-6,11-14,16-21H2,1-2H3,(H,33,36) |
| InChIKey | KMJPBJLFUZLIOD-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|