C28H30N2O3 — CID 19243566
1-benzoyl-3-methyl-5-[4-(4-methylphenoxy)butyl]-2,3-dihydro-1,5-benzodiazepin-4-one (PubChem CID 19243566) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1-benzoyl-3-methyl-5-[4-(4-methylphenoxy)butyl]-2,3-dihydro-1,5-benzodiazepin-4-one.
| Compound Name | 1-benzoyl-3-methyl-5-[4-(4-methylphenoxy)butyl]-2,3-dihydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 19243566 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 1-benzoyl-3-methyl-5-[4-(4-methylphenoxy)butyl]-2,3-dihydro-1,5-benzodiazepin-4-one |
| SMILES | Cc1ccc(OCCCCN2C(=O)C(C)CN(C(=O)c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H30N2O3/c1-21-14-16-24(17-15-21)33-19-9-8-18-29-25-12-6-7-13-26(25)30(20-22(2)27(29)31)28(32)23-10-4-3-5-11-23/h3-7,10-17,22H,8-9,18-20H2,1-2H3 |
| InChIKey | QFGUHPBBTFVAOW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|