C30H34N2O3 — CID 19243584
1-benzoyl-3-methyl-5-[4-(4-propan-2-ylphenoxy)butyl]-2,3-dihydro-1,5-benzodiazepin-4-one (PubChem CID 19243584) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is 1-benzoyl-3-methyl-5-[4-(4-propan-2-ylphenoxy)butyl]-2,3-dihydro-1,5-benzodiazepin-4-one.
| Compound Name | 1-benzoyl-3-methyl-5-[4-(4-propan-2-ylphenoxy)butyl]-2,3-dihydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 19243584 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 1-benzoyl-3-methyl-5-[4-(4-propan-2-ylphenoxy)butyl]-2,3-dihydro-1,5-benzodiazepin-4-one |
| SMILES | CC1CN(C(=O)c2ccccc2)c2ccccc2N(CCCCOc2ccc(C(C)C)cc2)C1=O |
| InChI | InChI=1S/C30H34N2O3/c1-22(2)24-15-17-26(18-16-24)35-20-10-9-19-31-27-13-7-8-14-28(27)32(21-23(3)29(31)33)30(34)25-11-5-4-6-12-25/h4-8,11-18,22-23H,9-10,19-21H2,1-3H3 |
| InChIKey | JGDNCUHPAFJQMO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|