C25H24N4O5S2 — CID 19244367
N-[4-(4-methoxy-2-methylphenyl)-1,2,5-oxadiazol-3-yl]-4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 19244367) has the molecular formula C25H24N4O5S2 and a molecular weight of 524.62 g/mol. Its IUPAC name is N-[4-(4-methoxy-2-methylphenyl)-1,2,5-oxadiazol-3-yl]-4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-[4-(4-methoxy-2-methylphenyl)-1,2,5-oxadiazol-3-yl]-4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 19244367 |
| Molecular Formula | C25H24N4O5S2 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | N-[4-(4-methoxy-2-methylphenyl)-1,2,5-oxadiazol-3-yl]-4-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | COc1ccc(/C=C2\SC(=S)N(CCCC(=O)Nc3nonc3-c3ccc(OC)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C25H24N4O5S2/c1-15-13-18(33-3)10-11-19(15)22-23(28-34-27-22)26-21(30)5-4-12-29-24(31)20(36-25(29)35)14-16-6-8-17(32-2)9-7-16/h6-11,13-14H,4-5,12H2,1-3H3,(H,26,28,30)/b20-14- |
| InChIKey | XFPLCJCETVKQFL-ZHZULCJRSA-N |
| XLogP | 4.68 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|