C24H21ClN4O4S2 — CID 19244370
4-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-(4-methoxy-2-methylphenyl)-1,2,5-oxadiazol-3-yl]butanamide (PubChem CID 19244370) has the molecular formula C24H21ClN4O4S2 and a molecular weight of 529.04 g/mol. Its IUPAC name is 4-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-(4-methoxy-2-methylphenyl)-1,2,5-oxadiazol-3-yl]butanamide.
| Compound Name | 4-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-(4-methoxy-2-methylphenyl)-1,2,5-oxadiazol-3-yl]butanamide |
|---|---|
| PubChem CID | 19244370 |
| Molecular Formula | C24H21ClN4O4S2 |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 4-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-(4-methoxy-2-methylphenyl)-1,2,5-oxadiazol-3-yl]butanamide |
| SMILES | COc1ccc(-c2nonc2NC(=O)CCCN2C(=O)/C(=C/c3ccc(Cl)cc3)SC2=S)c(C)c1 |
| InChI | InChI=1S/C24H21ClN4O4S2/c1-14-12-17(32-2)9-10-18(14)21-22(28-33-27-21)26-20(30)4-3-11-29-23(31)19(35-24(29)34)13-15-5-7-16(25)8-6-15/h5-10,12-13H,3-4,11H2,1-2H3,(H,26,28,30)/b19-13- |
| InChIKey | WEOPIYIGTHHDRC-UYRXBGFRSA-N |
| XLogP | 5.33 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|