C21H18N4O4S3 — CID 19244354
N-[4-(4-methoxy-2-methylphenyl)-1,2,5-oxadiazol-3-yl]-3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide (PubChem CID 19244354) has the molecular formula C21H18N4O4S3 and a molecular weight of 486.60 g/mol. Its IUPAC name is N-[4-(4-methoxy-2-methylphenyl)-1,2,5-oxadiazol-3-yl]-3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-[4-(4-methoxy-2-methylphenyl)-1,2,5-oxadiazol-3-yl]-3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 19244354 |
| Molecular Formula | C21H18N4O4S3 |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | N-[4-(4-methoxy-2-methylphenyl)-1,2,5-oxadiazol-3-yl]-3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide |
| SMILES | COc1ccc(-c2nonc2NC(=O)CCN2C(=O)/C(=C/c3cccs3)SC2=S)c(C)c1 |
| InChI | InChI=1S/C21H18N4O4S3/c1-12-10-13(28-2)5-6-15(12)18-19(24-29-23-18)22-17(26)7-8-25-20(27)16(32-21(25)30)11-14-4-3-9-31-14/h3-6,9-11H,7-8H2,1-2H3,(H,22,24,26)/b16-11- |
| InChIKey | FAXGJYGIQNDIAY-WJDWOHSUSA-N |
| XLogP | 4.35 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|