C24H21N3O2 — CID 19244584
N-[4-(2,5-dimethylphenyl)-1,2,5-oxadiazol-3-yl]-2,2-diphenylacetamide (PubChem CID 19244584) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[4-(2,5-dimethylphenyl)-1,2,5-oxadiazol-3-yl]-2,2-diphenylacetamide.
| Compound Name | N-[4-(2,5-dimethylphenyl)-1,2,5-oxadiazol-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 19244584 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[4-(2,5-dimethylphenyl)-1,2,5-oxadiazol-3-yl]-2,2-diphenylacetamide |
| SMILES | Cc1ccc(C)c(-c2nonc2NC(=O)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H21N3O2/c1-16-13-14-17(2)20(15-16)22-23(27-29-26-22)25-24(28)21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15,21H,1-2H3,(H,25,27,28) |
| InChIKey | RSDAKNVGCSLUJS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |