C14H21ClN4O3S — CID 19245749
5-chloro-2-ethylsulfonyl-N-methyl-N-(1-methylpiperidin-4-yl)pyrimidine-4-carboxamide (PubChem CID 19245749) has the molecular formula C14H21ClN4O3S and a molecular weight of 360.87 g/mol. Its IUPAC name is 5-chloro-2-ethylsulfonyl-N-methyl-N-(1-methylpiperidin-4-yl)pyrimidine-4-carboxamide.
| Compound Name | 5-chloro-2-ethylsulfonyl-N-methyl-N-(1-methylpiperidin-4-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 19245749 |
| Molecular Formula | C14H21ClN4O3S |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 5-chloro-2-ethylsulfonyl-N-methyl-N-(1-methylpiperidin-4-yl)pyrimidine-4-carboxamide |
| SMILES | CCS(=O)(=O)c1ncc(Cl)c(C(=O)N(C)C2CCN(C)CC2)n1 |
| InChI | InChI=1S/C14H21ClN4O3S/c1-4-23(21,22)14-16-9-11(15)12(17-14)13(20)19(3)10-5-7-18(2)8-6-10/h9-10H,4-8H2,1-3H3 |
| InChIKey | CYINSSVKQKGMLU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |