C26H21Cl2F3N2O2S2 — CID 19249976
2-[(1S,2R,9R,10S,11S)-9-(2,3-dichlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 19249976) has the molecular formula C26H21Cl2F3N2O2S2 and a molecular weight of 585.50 g/mol. Its IUPAC name is 2-[(1S,2R,9R,10S,11S)-9-(2,3-dichlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(1S,2R,9R,10S,11S)-9-(2,3-dichlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19249976 |
| Molecular Formula | C26H21Cl2F3N2O2S2 |
| Molecular Weight | 585.50 g/mol |
| Exact Mass | 584.04 |
| IUPAC Name | 2-[(1S,2R,9R,10S,11S)-9-(2,3-dichlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1cccc(Cl)c1Cl)[C@@H]1[C@H]3CC[C@@H](C3)[C@H]1S2)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H21Cl2F3N2O2S2/c27-17-6-2-5-16(21(17)28)20-19-12-7-8-13(9-12)22(19)36-24-23(20)37-25(35)33(24)11-18(34)32-15-4-1-3-14(10-15)26(29,30)31/h1-6,10,12-13,19-20,22H,7-9,11H2,(H,32,34)/t12-,13-,19-,20-,22+/m0/s1 |
| InChIKey | VXDIVZVFYLFIHY-NEPKKPNDSA-N |
| XLogP | 7.53 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.50 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|