C26H22ClF3N2O2S2 — CID 98156918
2-[(1S,2S,9S,10S,11R)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 98156918) has the molecular formula C26H22ClF3N2O2S2 and a molecular weight of 551.06 g/mol. Its IUPAC name is 2-[(1S,2S,9S,10S,11R)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(1S,2S,9S,10S,11R)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 98156918 |
| Molecular Formula | C26H22ClF3N2O2S2 |
| Molecular Weight | 551.06 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | 2-[(1S,2S,9S,10S,11R)-9-(4-chlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1ccc(Cl)cc1)[C@@H]1[C@@H]3CC[C@@H](C3)[C@@H]1S2)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H22ClF3N2O2S2/c27-17-8-6-13(7-9-17)20-21-14-4-5-15(10-14)22(21)35-24-23(20)36-25(34)32(24)12-19(33)31-18-3-1-2-16(11-18)26(28,29)30/h1-3,6-9,11,14-15,20-22H,4-5,10,12H2,(H,31,33)/t14-,15+,20-,21+,22+/m1/s1 |
| InChIKey | OKSBFMRTFHHGBT-WNPSXODFSA-N |
| XLogP | 6.87 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.06 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|