C25H22Cl2N2O3S2 — CID 16636674
2-[(9S)-9-(2,3-dichlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 16636674) has the molecular formula C25H22Cl2N2O3S2 and a molecular weight of 533.50 g/mol. Its IUPAC name is 2-[(9S)-9-(2,3-dichlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[(9S)-9-(2,3-dichlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 16636674 |
| Molecular Formula | C25H22Cl2N2O3S2 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 2-[(9S)-9-(2,3-dichlorophenyl)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-5-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)C(c1cccc(Cl)c1Cl)C1C3CCC(C3)C1S2)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C25H22Cl2N2O3S2/c26-17-3-1-2-16(21(17)27)20-19-12-4-5-13(10-12)22(19)33-24-23(20)34-25(32)29(24)11-18(31)28-14-6-8-15(30)9-7-14/h1-3,6-9,12-13,19-20,22,30H,4-5,10-11H2,(H,28,31) |
| InChIKey | ZNHCOLDXIWLOLX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|