C32H36BrN3O7S2 — CID 19255811
6-[(9S)-9-[5-bromo-2-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid (PubChem CID 19255811) has the molecular formula C32H36BrN3O7S2 and a molecular weight of 718.69 g/mol. Its IUPAC name is 6-[(9S)-9-[5-bromo-2-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid.
| Compound Name | 6-[(9S)-9-[5-bromo-2-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
|---|---|
| PubChem CID | 19255811 |
| Molecular Formula | C32H36BrN3O7S2 |
| Molecular Weight | 718.69 g/mol |
| Exact Mass | 717.12 |
| IUPAC Name | 6-[(9S)-9-[5-bromo-2-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C2C3CC(C2C1=O)C1C(c2cc(Br)ccc2OCC(=O)N2CCCCC2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C32H36BrN3O7S2/c33-16-8-9-20(43-15-21(37)35-10-4-2-5-11-35)17(13-16)23-24-18-14-19(27(24)44-29-28(23)45-32(42)34-29)26-25(18)30(40)36(31(26)41)12-6-1-3-7-22(38)39/h8-9,13,18-19,23-27H,1-7,10-12,14-15H2,(H,34,42)(H,38,39) |
| InChIKey | WVIWIAAQWDEBPE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|