C22H17N3OS — CID 19256284
(5Z)-5-(anthracen-9-ylmethylidene)-2-propyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 19256284) has the molecular formula C22H17N3OS and a molecular weight of 371.47 g/mol. Its IUPAC name is (5Z)-5-(anthracen-9-ylmethylidene)-2-propyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | (5Z)-5-(anthracen-9-ylmethylidene)-2-propyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 19256284 |
| Molecular Formula | C22H17N3OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (5Z)-5-(anthracen-9-ylmethylidene)-2-propyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | CCCc1nc2s/c(=C\c3c4ccccc4cc4ccccc34)c(=O)n2n1 |
| InChI | InChI=1S/C22H17N3OS/c1-2-7-20-23-22-25(24-20)21(26)19(27-22)13-18-16-10-5-3-8-14(16)12-15-9-4-6-11-17(15)18/h3-6,8-13H,2,7H2,1H3/b19-13- |
| InChIKey | KDPLVMXSZVUUGY-UYRXBGFRSA-N |
| XLogP | 3.96 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|