C18H15F2N3O2 — CID 19258406
ethyl 4-(2,4-difluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate (PubChem CID 19258406) has the molecular formula C18H15F2N3O2 and a molecular weight of 343.33 g/mol. Its IUPAC name is ethyl 4-(2,4-difluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 4-(2,4-difluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 19258406 |
| Molecular Formula | C18H15F2N3O2 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | ethyl 4-(2,4-difluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2nc(C)ccc2c1Nc1ccc(F)cc1F |
| InChI | InChI=1S/C18H15F2N3O2/c1-3-25-18(24)13-9-21-17-12(6-4-10(2)22-17)16(13)23-15-7-5-11(19)8-14(15)20/h4-9H,3H2,1-2H3,(H,21,22,23) |
| InChIKey | KMEUVONMICTVQF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |