C23H27N5O7 — CID 19266019
1-(1-adamantyl)-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-4-nitropyrazole-3-carboxamide (PubChem CID 19266019) has the molecular formula C23H27N5O7 and a molecular weight of 485.50 g/mol. Its IUPAC name is 1-(1-adamantyl)-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-4-nitropyrazole-3-carboxamide.
| Compound Name | 1-(1-adamantyl)-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19266019 |
| Molecular Formula | C23H27N5O7 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 1-(1-adamantyl)-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-4-nitropyrazole-3-carboxamide |
| SMILES | O=C(NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)c1nn(C23CC4CC(CC(C4)C2)C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H27N5O7/c29-12-18(21(30)16-1-3-17(4-2-16)27(32)33)24-22(31)20-19(28(34)35)11-26(25-20)23-8-13-5-14(9-23)7-15(6-13)10-23/h1-4,11,13-15,18,21,29-30H,5-10,12H2,(H,24,31) |
| InChIKey | GBRPTHGAXNTMBZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 173.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|