C22H23N3O3 — CID 19273323
N-(oxolan-2-ylmethyl)-1-[(4-phenylphenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19273323) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-1-[(4-phenylphenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-1-[(4-phenylphenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19273323 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-1-[(4-phenylphenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1ccn(COc2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C22H23N3O3/c26-22(23-15-20-7-4-14-27-20)21-12-13-25(24-21)16-28-19-10-8-18(9-11-19)17-5-2-1-3-6-17/h1-3,5-6,8-13,20H,4,7,14-16H2,(H,23,26) |
| InChIKey | DDFDKKGZJCGEKT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |